C18H18N2O4 — CID 108514413
N-(4-acetylphenyl)-N'-(4-ethoxyphenyl)oxamide (PubChem CID 108514413) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is N-(4-acetylphenyl)-N'-(4-ethoxyphenyl)oxamide.
| Compound Name | N-(4-acetylphenyl)-N'-(4-ethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 108514413 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | N-(4-acetylphenyl)-N'-(4-ethoxyphenyl)oxamide |
| SMILES | CCOc1ccc(NC(=O)C(=O)Nc2ccc(C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C18H18N2O4/c1-3-24-16-10-8-15(9-11-16)20-18(23)17(22)19-14-6-4-13(5-7-14)12(2)21/h4-11H,3H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | JLTNERNNIWLYKX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|