C23H20N2O4 — CID 108987469
N-(4-acetylphenyl)-N'-(4-phenylmethoxyphenyl)oxamide (PubChem CID 108987469) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is N-(4-acetylphenyl)-N'-(4-phenylmethoxyphenyl)oxamide.
| Compound Name | N-(4-acetylphenyl)-N'-(4-phenylmethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 108987469 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | N-(4-acetylphenyl)-N'-(4-phenylmethoxyphenyl)oxamide |
| SMILES | CC(=O)c1ccc(NC(=O)C(=O)Nc2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C23H20N2O4/c1-16(26)18-7-9-19(10-8-18)24-22(27)23(28)25-20-11-13-21(14-12-20)29-15-17-5-3-2-4-6-17/h2-14H,15H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | AANRDCAZPACMBS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|