C21H26N2O3 — CID 108986506
N-(4-phenylmethoxyphenyl)-N',N'-dipropyloxamide (PubChem CID 108986506) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is N-(4-phenylmethoxyphenyl)-N',N'-dipropyloxamide.
| Compound Name | N-(4-phenylmethoxyphenyl)-N',N'-dipropyloxamide |
|---|---|
| PubChem CID | 108986506 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N-(4-phenylmethoxyphenyl)-N',N'-dipropyloxamide |
| SMILES | CCCN(CCC)C(=O)C(=O)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H26N2O3/c1-3-14-23(15-4-2)21(25)20(24)22-18-10-12-19(13-11-18)26-16-17-8-6-5-7-9-17/h5-13H,3-4,14-16H2,1-2H3,(H,22,24) |
| InChIKey | HZQJYZYBXJHFIY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|