C28H23NO2 — CID 6534022
(E)-2,3-diphenyl-N-(4-phenylmethoxyphenyl)prop-2-enamide (PubChem CID 6534022) has the molecular formula C28H23NO2 and a molecular weight of 405.50 g/mol. Its IUPAC name is (E)-2,3-diphenyl-N-(4-phenylmethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-2,3-diphenyl-N-(4-phenylmethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6534022 |
| Molecular Formula | C28H23NO2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | (E)-2,3-diphenyl-N-(4-phenylmethoxyphenyl)prop-2-enamide |
| SMILES | O=C(Nc1ccc(OCc2ccccc2)cc1)/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H23NO2/c30-28(27(24-14-8-3-9-15-24)20-22-10-4-1-5-11-22)29-25-16-18-26(19-17-25)31-21-23-12-6-2-7-13-23/h1-20H,21H2,(H,29,30)/b27-20+ |
| InChIKey | ZMCJZMNLBJIWOP-NHFJDJAPSA-N |
| XLogP | 6.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|