C28H35NO3 — CID 143804226
ethane;(E)-2-(4-hydroxyphenyl)-3-phenyl-N-(4-propoxyphenyl)prop-2-enamide (PubChem CID 143804226) has the molecular formula C28H35NO3 and a molecular weight of 433.59 g/mol. Its IUPAC name is ethane;(E)-2-(4-hydroxyphenyl)-3-phenyl-N-(4-propoxyphenyl)prop-2-enamide.
| Compound Name | ethane;(E)-2-(4-hydroxyphenyl)-3-phenyl-N-(4-propoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 143804226 |
| Molecular Formula | C28H35NO3 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | ethane;(E)-2-(4-hydroxyphenyl)-3-phenyl-N-(4-propoxyphenyl)prop-2-enamide |
| SMILES | CC.CC.CCCOc1ccc(NC(=O)/C(=C/c2ccccc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C24H23NO3.2C2H6/c1-2-16-28-22-14-10-20(11-15-22)25-24(27)23(17-18-6-4-3-5-7-18)19-8-12-21(26)13-9-19;2*1-2/h3-15,17,26H,2,16H2,1H3,(H,25,27);2*1-2H3/b23-17+;; |
| InChIKey | XXQMEWNKUPKXEN-DQKALADDSA-N |
| XLogP | 7.41 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|