C23H21NO — CID 6534390
(E)-N-(4-ethylphenyl)-2,3-diphenylprop-2-enamide (PubChem CID 6534390) has the molecular formula C23H21NO and a molecular weight of 327.43 g/mol. Its IUPAC name is (E)-N-(4-ethylphenyl)-2,3-diphenylprop-2-enamide.
| Compound Name | (E)-N-(4-ethylphenyl)-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 6534390 |
| Molecular Formula | C23H21NO |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (E)-N-(4-ethylphenyl)-2,3-diphenylprop-2-enamide |
| SMILES | CCc1ccc(NC(=O)/C(=C/c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21NO/c1-2-18-13-15-21(16-14-18)24-23(25)22(20-11-7-4-8-12-20)17-19-9-5-3-6-10-19/h3-17H,2H2,1H3,(H,24,25)/b22-17+ |
| InChIKey | VODXPZJEBBVWAP-OQKWZONESA-N |
| XLogP | 5.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|