C25H21N3O — CID 1231817
(Z)-2,3-diphenyl-N-[4-(pyrazol-1-ylmethyl)phenyl]prop-2-enamide (PubChem CID 1231817) has the molecular formula C25H21N3O and a molecular weight of 379.46 g/mol. Its IUPAC name is (Z)-2,3-diphenyl-N-[4-(pyrazol-1-ylmethyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-2,3-diphenyl-N-[4-(pyrazol-1-ylmethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 1231817 |
| Molecular Formula | C25H21N3O |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | (Z)-2,3-diphenyl-N-[4-(pyrazol-1-ylmethyl)phenyl]prop-2-enamide |
| SMILES | O=C(Nc1ccc(Cn2cccn2)cc1)/C(=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H21N3O/c29-25(27-23-14-12-21(13-15-23)19-28-17-7-16-26-28)24(22-10-5-2-6-11-22)18-20-8-3-1-4-9-20/h1-18H,19H2,(H,27,29)/b24-18- |
| InChIKey | PPOIQGFHTXTGNO-MOHJPFBDSA-N |
| XLogP | 5.11 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|