C30H34N2O2 — CID 108760697
(E)-3-(4-ethoxyphenyl)-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]-2-phenylprop-2-enamide (PubChem CID 108760697) has the molecular formula C30H34N2O2 and a molecular weight of 454.61 g/mol. Its IUPAC name is (E)-3-(4-ethoxyphenyl)-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]-2-phenylprop-2-enamide.
| Compound Name | (E)-3-(4-ethoxyphenyl)-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 108760697 |
| Molecular Formula | C30H34N2O2 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | (E)-3-(4-ethoxyphenyl)-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]-2-phenylprop-2-enamide |
| SMILES | CCOc1ccc(/C=C(/C(=O)Nc2ccc(CN3CCC(C)CC3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H34N2O2/c1-3-34-28-15-11-24(12-16-28)21-29(26-7-5-4-6-8-26)30(33)31-27-13-9-25(10-14-27)22-32-19-17-23(2)18-20-32/h4-16,21,23H,3,17-20,22H2,1-2H3,(H,31,33)/b29-21+ |
| InChIKey | ZPPABVWXMNPYMD-XHLNEMQHSA-N |
| XLogP | 6.50 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|