C25H20ClN3O — CID 19283657
(Z)-N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-2,3-diphenylprop-2-enamide (PubChem CID 19283657) has the molecular formula C25H20ClN3O and a molecular weight of 413.91 g/mol. Its IUPAC name is (Z)-N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-2,3-diphenylprop-2-enamide.
| Compound Name | (Z)-N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 19283657 |
| Molecular Formula | C25H20ClN3O |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | (Z)-N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-2,3-diphenylprop-2-enamide |
| SMILES | O=C(Nc1ccn(Cc2ccc(Cl)cc2)n1)/C(=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H20ClN3O/c26-22-13-11-20(12-14-22)18-29-16-15-24(28-29)27-25(30)23(21-9-5-2-6-10-21)17-19-7-3-1-4-8-19/h1-17H,18H2,(H,27,28,30)/b23-17- |
| InChIKey | SAJJQLVFZYUYKI-QJOMJCCJSA-N |
| XLogP | 5.76 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|