C26H21Cl2N3O — CID 19392916
(Z)-N-[1-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-2,3-diphenylprop-2-enamide (PubChem CID 19392916) has the molecular formula C26H21Cl2N3O and a molecular weight of 462.38 g/mol. Its IUPAC name is (Z)-N-[1-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-2,3-diphenylprop-2-enamide.
| Compound Name | (Z)-N-[1-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 19392916 |
| Molecular Formula | C26H21Cl2N3O |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | (Z)-N-[1-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-2,3-diphenylprop-2-enamide |
| SMILES | Cc1cc(NC(=O)/C(=C\c2ccccc2)c2ccccc2)nn1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H21Cl2N3O/c1-18-14-25(30-31(18)17-20-12-13-23(27)24(28)16-20)29-26(32)22(21-10-6-3-7-11-21)15-19-8-4-2-5-9-19/h2-16H,17H2,1H3,(H,29,30,32)/b22-15- |
| InChIKey | SGLUZBJBOLRCSX-JCMHNJIXSA-N |
| XLogP | 6.73 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|