C29H26Cl2N4O — CID 19392897
1-benzyl-N-[1-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-2,3-dimethylindole-5-carboxamide (PubChem CID 19392897) has the molecular formula C29H26Cl2N4O and a molecular weight of 517.46 g/mol. Its IUPAC name is 1-benzyl-N-[1-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-2,3-dimethylindole-5-carboxamide.
| Compound Name | 1-benzyl-N-[1-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-2,3-dimethylindole-5-carboxamide |
|---|---|
| PubChem CID | 19392897 |
| Molecular Formula | C29H26Cl2N4O |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 1-benzyl-N-[1-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-2,3-dimethylindole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2ccccc2)c2ccc(C(=O)Nc3cc(C)n(Cc4ccc(Cl)c(Cl)c4)n3)cc12 |
| InChI | InChI=1S/C29H26Cl2N4O/c1-18-13-28(33-35(18)17-22-9-11-25(30)26(31)14-22)32-29(36)23-10-12-27-24(15-23)19(2)20(3)34(27)16-21-7-5-4-6-8-21/h4-15H,16-17H2,1-3H3,(H,32,33,36) |
| InChIKey | IINFYGBJZDSSAO-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|