C28H24ClFN4O — CID 19409276
1-benzyl-N-[4-chloro-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-2,3-dimethylindole-5-carboxamide (PubChem CID 19409276) has the molecular formula C28H24ClFN4O and a molecular weight of 486.98 g/mol. Its IUPAC name is 1-benzyl-N-[4-chloro-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-2,3-dimethylindole-5-carboxamide.
| Compound Name | 1-benzyl-N-[4-chloro-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-2,3-dimethylindole-5-carboxamide |
|---|---|
| PubChem CID | 19409276 |
| Molecular Formula | C28H24ClFN4O |
| Molecular Weight | 486.98 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 1-benzyl-N-[4-chloro-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-2,3-dimethylindole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2ccccc2)c2ccc(C(=O)Nc3nn(Cc4ccccc4F)cc3Cl)cc12 |
| InChI | InChI=1S/C28H24ClFN4O/c1-18-19(2)34(15-20-8-4-3-5-9-20)26-13-12-21(14-23(18)26)28(35)31-27-24(29)17-33(32-27)16-22-10-6-7-11-25(22)30/h3-14,17H,15-16H2,1-2H3,(H,31,32,35) |
| InChIKey | HRGHESIPNVVCBT-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.98 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|