C28H25ClN4O — CID 19283645
1-benzyl-N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-2,3-dimethylindole-5-carboxamide (PubChem CID 19283645) has the molecular formula C28H25ClN4O and a molecular weight of 468.99 g/mol. Its IUPAC name is 1-benzyl-N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-2,3-dimethylindole-5-carboxamide.
| Compound Name | 1-benzyl-N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-2,3-dimethylindole-5-carboxamide |
|---|---|
| PubChem CID | 19283645 |
| Molecular Formula | C28H25ClN4O |
| Molecular Weight | 468.99 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 1-benzyl-N-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-2,3-dimethylindole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2ccccc2)c2ccc(C(=O)Nc3ccn(Cc4ccc(Cl)cc4)n3)cc12 |
| InChI | InChI=1S/C28H25ClN4O/c1-19-20(2)33(18-21-6-4-3-5-7-21)26-13-10-23(16-25(19)26)28(34)30-27-14-15-32(31-27)17-22-8-11-24(29)12-9-22/h3-16H,17-18H2,1-2H3,(H,30,31,34) |
| InChIKey | CUEZXIYAVYVYHI-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.99 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|