C25H22ClN3O — CID 6875064
1-benzyl-N-[(E)-(4-chlorophenyl)methylideneamino]-2,3-dimethylindole-5-carboxamide (PubChem CID 6875064) has the molecular formula C25H22ClN3O and a molecular weight of 415.92 g/mol. Its IUPAC name is 1-benzyl-N-[(E)-(4-chlorophenyl)methylideneamino]-2,3-dimethylindole-5-carboxamide.
| Compound Name | 1-benzyl-N-[(E)-(4-chlorophenyl)methylideneamino]-2,3-dimethylindole-5-carboxamide |
|---|---|
| PubChem CID | 6875064 |
| Molecular Formula | C25H22ClN3O |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 1-benzyl-N-[(E)-(4-chlorophenyl)methylideneamino]-2,3-dimethylindole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2ccccc2)c2ccc(C(=O)N/N=C/c3ccc(Cl)cc3)cc12 |
| InChI | InChI=1S/C25H22ClN3O/c1-17-18(2)29(16-20-6-4-3-5-7-20)24-13-10-21(14-23(17)24)25(30)28-27-15-19-8-11-22(26)12-9-19/h3-15H,16H2,1-2H3,(H,28,30)/b27-15+ |
| InChIKey | UHGQPIYSKDUCHY-JFLMPSFJSA-N |
| XLogP | 5.72 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|