C28H22F4N4O — CID 19286379
1-benzyl-2,3-dimethyl-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]indole-5-carboxamide (PubChem CID 19286379) has the molecular formula C28H22F4N4O and a molecular weight of 506.50 g/mol. Its IUPAC name is 1-benzyl-2,3-dimethyl-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]indole-5-carboxamide.
| Compound Name | 1-benzyl-2,3-dimethyl-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]indole-5-carboxamide |
|---|---|
| PubChem CID | 19286379 |
| Molecular Formula | C28H22F4N4O |
| Molecular Weight | 506.50 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 1-benzyl-2,3-dimethyl-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]indole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2ccccc2)c2ccc(C(=O)Nc3ccn(Cc4c(F)c(F)cc(F)c4F)n3)cc12 |
| InChI | InChI=1S/C28H22F4N4O/c1-16-17(2)36(14-18-6-4-3-5-7-18)24-9-8-19(12-20(16)24)28(37)33-25-10-11-35(34-25)15-21-26(31)22(29)13-23(30)27(21)32/h3-13H,14-15H2,1-2H3,(H,33,34,37) |
| InChIKey | PLOOGWPJKKWEOH-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.50 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|