C20H15F6N3O3 — CID 19286564
4-(difluoromethoxy)-3-ethoxy-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]benzamide (PubChem CID 19286564) has the molecular formula C20H15F6N3O3 and a molecular weight of 459.35 g/mol. Its IUPAC name is 4-(difluoromethoxy)-3-ethoxy-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]benzamide.
| Compound Name | 4-(difluoromethoxy)-3-ethoxy-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 19286564 |
| Molecular Formula | C20H15F6N3O3 |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 4-(difluoromethoxy)-3-ethoxy-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]benzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccn(Cc3c(F)c(F)cc(F)c3F)n2)ccc1OC(F)F |
| InChI | InChI=1S/C20H15F6N3O3/c1-2-31-15-7-10(3-4-14(15)32-20(25)26)19(30)27-16-5-6-29(28-16)9-11-17(23)12(21)8-13(22)18(11)24/h3-8,20H,2,9H2,1H3,(H,27,28,30) |
| InChIKey | GKZUYZNSLNDSLL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|