C19H12F7N3O3 — CID 19286821
4-(difluoromethoxy)-3-methoxy-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide (PubChem CID 19286821) has the molecular formula C19H12F7N3O3 and a molecular weight of 463.31 g/mol. Its IUPAC name is 4-(difluoromethoxy)-3-methoxy-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide.
| Compound Name | 4-(difluoromethoxy)-3-methoxy-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 19286821 |
| Molecular Formula | C19H12F7N3O3 |
| Molecular Weight | 463.31 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | 4-(difluoromethoxy)-3-methoxy-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]benzamide |
| SMILES | COc1cc(C(=O)Nc2ccn(Cc3c(F)c(F)c(F)c(F)c3F)n2)ccc1OC(F)F |
| InChI | InChI=1S/C19H12F7N3O3/c1-31-11-6-8(2-3-10(11)32-19(25)26)18(30)27-12-4-5-29(28-12)7-9-13(20)15(22)17(24)16(23)14(9)21/h2-6,19H,7H2,1H3,(H,27,28,30) |
| InChIKey | OEHVSPFCCCNVHX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.31 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|