C16H19F2N3O3 — CID 19462618
4-(difluoromethoxy)-N-[1-(1-ethylpyrazol-3-yl)ethyl]-3-methoxybenzamide (PubChem CID 19462618) has the molecular formula C16H19F2N3O3 and a molecular weight of 339.34 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[1-(1-ethylpyrazol-3-yl)ethyl]-3-methoxybenzamide.
| Compound Name | 4-(difluoromethoxy)-N-[1-(1-ethylpyrazol-3-yl)ethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 19462618 |
| Molecular Formula | C16H19F2N3O3 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 4-(difluoromethoxy)-N-[1-(1-ethylpyrazol-3-yl)ethyl]-3-methoxybenzamide |
| SMILES | CCn1ccc(C(C)NC(=O)c2ccc(OC(F)F)c(OC)c2)n1 |
| InChI | InChI=1S/C16H19F2N3O3/c1-4-21-8-7-12(20-21)10(2)19-15(22)11-5-6-13(24-16(17)18)14(9-11)23-3/h5-10,16H,4H2,1-3H3,(H,19,22) |
| InChIKey | FKWYKOJXNFGWNF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |