C17H16BrF2NO3 — CID 9220094
N-[(1S)-1-(2-bromophenyl)ethyl]-4-(difluoromethoxy)-3-methoxybenzamide (PubChem CID 9220094) has the molecular formula C17H16BrF2NO3 and a molecular weight of 400.22 g/mol. Its IUPAC name is N-[(1S)-1-(2-bromophenyl)ethyl]-4-(difluoromethoxy)-3-methoxybenzamide.
| Compound Name | N-[(1S)-1-(2-bromophenyl)ethyl]-4-(difluoromethoxy)-3-methoxybenzamide |
|---|---|
| PubChem CID | 9220094 |
| Molecular Formula | C17H16BrF2NO3 |
| Molecular Weight | 400.22 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | N-[(1S)-1-(2-bromophenyl)ethyl]-4-(difluoromethoxy)-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)N[C@@H](C)c2ccccc2Br)ccc1OC(F)F |
| InChI | InChI=1S/C17H16BrF2NO3/c1-10(12-5-3-4-6-13(12)18)21-16(22)11-7-8-14(24-17(19)20)15(9-11)23-2/h3-10,17H,1-2H3,(H,21,22)/t10-/m0/s1 |
| InChIKey | JUNQSMPIFLIGEN-JTQLQIEISA-N |
| XLogP | 4.55 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.22 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |