C14H15F2N3O3 — CID 97245131
3-(difluoromethoxy)-4-methoxy-N-[(1R)-1-(1H-pyrazol-4-yl)ethyl]benzamide (PubChem CID 97245131) has the molecular formula C14H15F2N3O3 and a molecular weight of 311.29 g/mol. Its IUPAC name is 3-(difluoromethoxy)-4-methoxy-N-[(1R)-1-(1H-pyrazol-4-yl)ethyl]benzamide.
| Compound Name | 3-(difluoromethoxy)-4-methoxy-N-[(1R)-1-(1H-pyrazol-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 97245131 |
| Molecular Formula | C14H15F2N3O3 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 3-(difluoromethoxy)-4-methoxy-N-[(1R)-1-(1H-pyrazol-4-yl)ethyl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@H](C)c2cn[nH]c2)cc1OC(F)F |
| InChI | InChI=1S/C14H15F2N3O3/c1-8(10-6-17-18-7-10)19-13(20)9-3-4-11(21-2)12(5-9)22-14(15)16/h3-8,14H,1-2H3,(H,17,18)(H,19,20)/t8-/m1/s1 |
| InChIKey | BBBDMOJXEMWUCC-MRVPVSSYSA-N |
| XLogP | 2.51 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |