C20H19F2N3O2 — CID 118668478
3-(difluoromethoxy)-N-[(1R)-1-(4-methylphenyl)ethyl]-4-(1H-pyrazol-4-yl)benzamide (PubChem CID 118668478) has the molecular formula C20H19F2N3O2 and a molecular weight of 371.39 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-[(1R)-1-(4-methylphenyl)ethyl]-4-(1H-pyrazol-4-yl)benzamide.
| Compound Name | 3-(difluoromethoxy)-N-[(1R)-1-(4-methylphenyl)ethyl]-4-(1H-pyrazol-4-yl)benzamide |
|---|---|
| PubChem CID | 118668478 |
| Molecular Formula | C20H19F2N3O2 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 3-(difluoromethoxy)-N-[(1R)-1-(4-methylphenyl)ethyl]-4-(1H-pyrazol-4-yl)benzamide |
| SMILES | Cc1ccc([C@@H](C)NC(=O)c2ccc(-c3cn[nH]c3)c(OC(F)F)c2)cc1 |
| InChI | InChI=1S/C20H19F2N3O2/c1-12-3-5-14(6-4-12)13(2)25-19(26)15-7-8-17(16-10-23-24-11-16)18(9-15)27-20(21)22/h3-11,13,20H,1-2H3,(H,23,24)(H,25,26)/t13-/m1/s1 |
| InChIKey | GLJCHZXXWOWIBW-CYBMUJFWSA-N |
| XLogP | 4.48 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |