C20H21FN4O — CID 90375300
3-(dimethylamino)-N-[1-(4-fluorophenyl)ethyl]-4-(1H-pyrazol-4-yl)benzamide (PubChem CID 90375300) has the molecular formula C20H21FN4O and a molecular weight of 352.41 g/mol. Its IUPAC name is 3-(dimethylamino)-N-[1-(4-fluorophenyl)ethyl]-4-(1H-pyrazol-4-yl)benzamide.
| Compound Name | 3-(dimethylamino)-N-[1-(4-fluorophenyl)ethyl]-4-(1H-pyrazol-4-yl)benzamide |
|---|---|
| PubChem CID | 90375300 |
| Molecular Formula | C20H21FN4O |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 3-(dimethylamino)-N-[1-(4-fluorophenyl)ethyl]-4-(1H-pyrazol-4-yl)benzamide |
| SMILES | CC(NC(=O)c1ccc(-c2cn[nH]c2)c(N(C)C)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H21FN4O/c1-13(14-4-7-17(21)8-5-14)24-20(26)15-6-9-18(16-11-22-23-12-16)19(10-15)25(2)3/h4-13H,1-3H3,(H,22,23)(H,24,26) |
| InChIKey | YDXHQXWWAIVGGE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |