C18H14Cl2IN3O — CID 19392905
N-[1-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-2-iodobenzamide (PubChem CID 19392905) has the molecular formula C18H14Cl2IN3O and a molecular weight of 486.14 g/mol. Its IUPAC name is N-[1-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-2-iodobenzamide.
| Compound Name | N-[1-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-2-iodobenzamide |
|---|---|
| PubChem CID | 19392905 |
| Molecular Formula | C18H14Cl2IN3O |
| Molecular Weight | 486.14 g/mol |
| Exact Mass | 484.96 |
| IUPAC Name | N-[1-[(3,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]-2-iodobenzamide |
| SMILES | Cc1cc(NC(=O)c2ccccc2I)nn1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H14Cl2IN3O/c1-11-8-17(22-18(25)13-4-2-3-5-16(13)21)23-24(11)10-12-6-7-14(19)15(20)9-12/h2-9H,10H2,1H3,(H,22,23,25) |
| InChIKey | QGCAYKASGIEFRA-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.14 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|