C27H23Cl2N3O — CID 19335964
(Z)-N-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-2,3-diphenylprop-2-enamide (PubChem CID 19335964) has the molecular formula C27H23Cl2N3O and a molecular weight of 476.41 g/mol. Its IUPAC name is (Z)-N-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-2,3-diphenylprop-2-enamide.
| Compound Name | (Z)-N-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 19335964 |
| Molecular Formula | C27H23Cl2N3O |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | (Z)-N-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-2,3-diphenylprop-2-enamide |
| SMILES | Cc1nn(Cc2c(Cl)cccc2Cl)c(C)c1NC(=O)/C(=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H23Cl2N3O/c1-18-26(19(2)32(31-18)17-23-24(28)14-9-15-25(23)29)30-27(33)22(21-12-7-4-8-13-21)16-20-10-5-3-6-11-20/h3-16H,17H2,1-2H3,(H,30,33)/b22-16- |
| InChIKey | BRFASDVXWPUWLU-JWGURIENSA-N |
| XLogP | 7.03 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|