C27H20Cl2N4O3 — CID 19335993
N-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(1,3-dioxoisoindol-2-yl)benzamide (PubChem CID 19335993) has the molecular formula C27H20Cl2N4O3 and a molecular weight of 519.39 g/mol. Its IUPAC name is N-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(1,3-dioxoisoindol-2-yl)benzamide.
| Compound Name | N-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(1,3-dioxoisoindol-2-yl)benzamide |
|---|---|
| PubChem CID | 19335993 |
| Molecular Formula | C27H20Cl2N4O3 |
| Molecular Weight | 519.39 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | N-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(1,3-dioxoisoindol-2-yl)benzamide |
| SMILES | Cc1nn(Cc2c(Cl)cccc2Cl)c(C)c1NC(=O)c1cccc(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C27H20Cl2N4O3/c1-15-24(16(2)32(31-15)14-21-22(28)11-6-12-23(21)29)30-25(34)17-7-5-8-18(13-17)33-26(35)19-9-3-4-10-20(19)27(33)36/h3-13H,14H2,1-2H3,(H,30,34) |
| InChIKey | XTUCRSLVSSJTFK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.39 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|