C28H24N4O3 — CID 19338646
N-[3,5-dimethyl-1-[(3-methylphenyl)methyl]pyrazol-4-yl]-3-(1,3-dioxoisoindol-2-yl)benzamide (PubChem CID 19338646) has the molecular formula C28H24N4O3 and a molecular weight of 464.53 g/mol. Its IUPAC name is N-[3,5-dimethyl-1-[(3-methylphenyl)methyl]pyrazol-4-yl]-3-(1,3-dioxoisoindol-2-yl)benzamide.
| Compound Name | N-[3,5-dimethyl-1-[(3-methylphenyl)methyl]pyrazol-4-yl]-3-(1,3-dioxoisoindol-2-yl)benzamide |
|---|---|
| PubChem CID | 19338646 |
| Molecular Formula | C28H24N4O3 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | N-[3,5-dimethyl-1-[(3-methylphenyl)methyl]pyrazol-4-yl]-3-(1,3-dioxoisoindol-2-yl)benzamide |
| SMILES | Cc1cccc(Cn2nc(C)c(NC(=O)c3cccc(N4C(=O)c5ccccc5C4=O)c3)c2C)c1 |
| InChI | InChI=1S/C28H24N4O3/c1-17-8-6-9-20(14-17)16-31-19(3)25(18(2)30-31)29-26(33)21-10-7-11-22(15-21)32-27(34)23-12-4-5-13-24(23)28(32)35/h4-15H,16H2,1-3H3,(H,29,33) |
| InChIKey | NZPKDWJJGJKGNO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|