C21H15Cl2NO — CID 6526443
(E)-N-(2,5-dichlorophenyl)-2,3-diphenylprop-2-enamide (PubChem CID 6526443) has the molecular formula C21H15Cl2NO and a molecular weight of 368.26 g/mol. Its IUPAC name is (E)-N-(2,5-dichlorophenyl)-2,3-diphenylprop-2-enamide.
| Compound Name | (E)-N-(2,5-dichlorophenyl)-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 6526443 |
| Molecular Formula | C21H15Cl2NO |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | (E)-N-(2,5-dichlorophenyl)-2,3-diphenylprop-2-enamide |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H15Cl2NO/c22-17-11-12-19(23)20(14-17)24-21(25)18(16-9-5-2-6-10-16)13-15-7-3-1-4-8-15/h1-14H,(H,24,25)/b18-13+ |
| InChIKey | LMKLSWJOWGUQDO-QGOAFFKASA-N |
| XLogP | 6.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|