C13H10Cl2INO — CID 175991469
N-(2,5-dichlorophenyl)benzamide;hydroiodide (PubChem CID 175991469) has the molecular formula C13H10Cl2INO and a molecular weight of 394.04 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)benzamide;hydroiodide.
| Compound Name | N-(2,5-dichlorophenyl)benzamide;hydroiodide |
|---|---|
| PubChem CID | 175991469 |
| Molecular Formula | C13H10Cl2INO |
| Molecular Weight | 394.04 g/mol |
| Exact Mass | 392.92 |
| IUPAC Name | N-(2,5-dichlorophenyl)benzamide;hydroiodide |
| SMILES | I.O=C(Nc1cc(Cl)ccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C13H9Cl2NO.HI/c14-10-6-7-11(15)12(8-10)16-13(17)9-4-2-1-3-5-9;/h1-8H,(H,16,17);1H |
| InChIKey | MWVHPMRJUFYORM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.04 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|