C13H8BrCl2NO — CID 763593
4-bromo-N-(2,5-dichlorophenyl)benzamide (PubChem CID 763593) has the molecular formula C13H8BrCl2NO and a molecular weight of 345.02 g/mol. Its IUPAC name is 4-bromo-N-(2,5-dichlorophenyl)benzamide.
| Compound Name | 4-bromo-N-(2,5-dichlorophenyl)benzamide |
|---|---|
| PubChem CID | 763593 |
| Molecular Formula | C13H8BrCl2NO |
| Molecular Weight | 345.02 g/mol |
| Exact Mass | 342.92 |
| IUPAC Name | 4-bromo-N-(2,5-dichlorophenyl)benzamide |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H8BrCl2NO/c14-9-3-1-8(2-4-9)13(18)17-12-7-10(15)5-6-11(12)16/h1-7H,(H,17,18) |
| InChIKey | BQZOKSGAOBHKTO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.02 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |