C21H17Cl2N3O2 — CID 54839125
N-[3-[[2-(2,5-dichloroanilino)-2-oxoethyl]amino]phenyl]benzamide (PubChem CID 54839125) has the molecular formula C21H17Cl2N3O2 and a molecular weight of 414.29 g/mol. Its IUPAC name is N-[3-[[2-(2,5-dichloroanilino)-2-oxoethyl]amino]phenyl]benzamide.
| Compound Name | N-[3-[[2-(2,5-dichloroanilino)-2-oxoethyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 54839125 |
| Molecular Formula | C21H17Cl2N3O2 |
| Molecular Weight | 414.29 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | N-[3-[[2-(2,5-dichloroanilino)-2-oxoethyl]amino]phenyl]benzamide |
| SMILES | O=C(CNc1cccc(NC(=O)c2ccccc2)c1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C21H17Cl2N3O2/c22-15-9-10-18(23)19(11-15)26-20(27)13-24-16-7-4-8-17(12-16)25-21(28)14-5-2-1-3-6-14/h1-12,24H,13H2,(H,25,28)(H,26,27) |
| InChIKey | ALSKEJHBWLSJHO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.29 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |