C19H21Cl2N3O2 — CID 54819787
N-tert-butyl-3-[[2-(2,5-dichloroanilino)acetyl]amino]benzamide (PubChem CID 54819787) has the molecular formula C19H21Cl2N3O2 and a molecular weight of 394.30 g/mol. Its IUPAC name is N-tert-butyl-3-[[2-(2,5-dichloroanilino)acetyl]amino]benzamide.
| Compound Name | N-tert-butyl-3-[[2-(2,5-dichloroanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54819787 |
| Molecular Formula | C19H21Cl2N3O2 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | N-tert-butyl-3-[[2-(2,5-dichloroanilino)acetyl]amino]benzamide |
| SMILES | CC(C)(C)NC(=O)c1cccc(NC(=O)CNc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C19H21Cl2N3O2/c1-19(2,3)24-18(26)12-5-4-6-14(9-12)23-17(25)11-22-16-10-13(20)7-8-15(16)21/h4-10,22H,11H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | USPLTAGNISGHKP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |