C23H21Cl2N3O2 — CID 54810893
3-[[2-(2,4-dichloroanilino)acetyl]amino]-N-(1-phenylethyl)benzamide (PubChem CID 54810893) has the molecular formula C23H21Cl2N3O2 and a molecular weight of 442.35 g/mol. Its IUPAC name is 3-[[2-(2,4-dichloroanilino)acetyl]amino]-N-(1-phenylethyl)benzamide.
| Compound Name | 3-[[2-(2,4-dichloroanilino)acetyl]amino]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 54810893 |
| Molecular Formula | C23H21Cl2N3O2 |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 3-[[2-(2,4-dichloroanilino)acetyl]amino]-N-(1-phenylethyl)benzamide |
| SMILES | CC(NC(=O)c1cccc(NC(=O)CNc2ccc(Cl)cc2Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C23H21Cl2N3O2/c1-15(16-6-3-2-4-7-16)27-23(30)17-8-5-9-19(12-17)28-22(29)14-26-21-11-10-18(24)13-20(21)25/h2-13,15,26H,14H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | VIEWPPMRUBBONH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |