C26H29N3O2 — CID 54811860
N-(1-phenylethyl)-3-[[2-(2,4,6-trimethylanilino)acetyl]amino]benzamide (PubChem CID 54811860) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is N-(1-phenylethyl)-3-[[2-(2,4,6-trimethylanilino)acetyl]amino]benzamide.
| Compound Name | N-(1-phenylethyl)-3-[[2-(2,4,6-trimethylanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54811860 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | N-(1-phenylethyl)-3-[[2-(2,4,6-trimethylanilino)acetyl]amino]benzamide |
| SMILES | Cc1cc(C)c(NCC(=O)Nc2cccc(C(=O)NC(C)c3ccccc3)c2)c(C)c1 |
| InChI | InChI=1S/C26H29N3O2/c1-17-13-18(2)25(19(3)14-17)27-16-24(30)29-23-12-8-11-22(15-23)26(31)28-20(4)21-9-6-5-7-10-21/h5-15,20,27H,16H2,1-4H3,(H,28,31)(H,29,30) |
| InChIKey | OVTQJQPQZVEXQA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |