C25H27N3O2 — CID 54841883
3-[[2-(2,5-dimethylanilino)-2-oxoethyl]amino]-N-(1-phenylethyl)benzamide (PubChem CID 54841883) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is 3-[[2-(2,5-dimethylanilino)-2-oxoethyl]amino]-N-(1-phenylethyl)benzamide.
| Compound Name | 3-[[2-(2,5-dimethylanilino)-2-oxoethyl]amino]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 54841883 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 3-[[2-(2,5-dimethylanilino)-2-oxoethyl]amino]-N-(1-phenylethyl)benzamide |
| SMILES | Cc1ccc(C)c(NC(=O)CNc2cccc(C(=O)NC(C)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C25H27N3O2/c1-17-12-13-18(2)23(14-17)28-24(29)16-26-22-11-7-10-21(15-22)25(30)27-19(3)20-8-5-4-6-9-20/h4-15,19,26H,16H2,1-3H3,(H,27,30)(H,28,29) |
| InChIKey | OECHORPFQSOUKV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |