C25H26N2O3S — CID 6523072
(E)-N-[4-(tert-butylsulfamoyl)phenyl]-2,3-diphenylprop-2-enamide (PubChem CID 6523072) has the molecular formula C25H26N2O3S and a molecular weight of 434.56 g/mol. Its IUPAC name is (E)-N-[4-(tert-butylsulfamoyl)phenyl]-2,3-diphenylprop-2-enamide.
| Compound Name | (E)-N-[4-(tert-butylsulfamoyl)phenyl]-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 6523072 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | (E)-N-[4-(tert-butylsulfamoyl)phenyl]-2,3-diphenylprop-2-enamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(NC(=O)/C(=C/c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H26N2O3S/c1-25(2,3)27-31(29,30)22-16-14-21(15-17-22)26-24(28)23(20-12-8-5-9-13-20)18-19-10-6-4-7-11-19/h4-18,27H,1-3H3,(H,26,28)/b23-18+ |
| InChIKey | HFKDCJVSXDVWGG-PTGBLXJZSA-N |
| XLogP | 4.94 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|