C30H28N2O5S — CID 43881759
(E)-N-[4-[(2-methoxy-5-methylphenyl)sulfamoyl]phenyl]-3-(4-methoxyphenyl)-2-phenylprop-2-enamide (PubChem CID 43881759) has the molecular formula C30H28N2O5S and a molecular weight of 528.63 g/mol. Its IUPAC name is (E)-N-[4-[(2-methoxy-5-methylphenyl)sulfamoyl]phenyl]-3-(4-methoxyphenyl)-2-phenylprop-2-enamide.
| Compound Name | (E)-N-[4-[(2-methoxy-5-methylphenyl)sulfamoyl]phenyl]-3-(4-methoxyphenyl)-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 43881759 |
| Molecular Formula | C30H28N2O5S |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | (E)-N-[4-[(2-methoxy-5-methylphenyl)sulfamoyl]phenyl]-3-(4-methoxyphenyl)-2-phenylprop-2-enamide |
| SMILES | COc1ccc(/C=C(/C(=O)Nc2ccc(S(=O)(=O)Nc3cc(C)ccc3OC)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H28N2O5S/c1-21-9-18-29(37-3)28(19-21)32-38(34,35)26-16-12-24(13-17-26)31-30(33)27(23-7-5-4-6-8-23)20-22-10-14-25(36-2)15-11-22/h4-20,32H,1-3H3,(H,31,33)/b27-20+ |
| InChIKey | QGGLNXSIOIWPHB-NHFJDJAPSA-N |
| XLogP | 5.99 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|