C21H21N3O4S2 — CID 19678993
1-(4-methoxyphenyl)-3-[4-[(2-methoxyphenyl)sulfamoyl]phenyl]thiourea (PubChem CID 19678993) has the molecular formula C21H21N3O4S2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[4-[(2-methoxyphenyl)sulfamoyl]phenyl]thiourea.
| Compound Name | 1-(4-methoxyphenyl)-3-[4-[(2-methoxyphenyl)sulfamoyl]phenyl]thiourea |
|---|---|
| PubChem CID | 19678993 |
| Molecular Formula | C21H21N3O4S2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[4-[(2-methoxyphenyl)sulfamoyl]phenyl]thiourea |
| SMILES | COc1ccc(NC(=S)Nc2ccc(S(=O)(=O)Nc3ccccc3OC)cc2)cc1 |
| InChI | InChI=1S/C21H21N3O4S2/c1-27-17-11-7-15(8-12-17)22-21(29)23-16-9-13-18(14-10-16)30(25,26)24-19-5-3-4-6-20(19)28-2/h3-14,24H,1-2H3,(H2,22,23,29) |
| InChIKey | YCUCEDQRNYTOAM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|