C18H18N4O4S2 — CID 25046157
1-(2-methoxyphenyl)-3-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]thiourea (PubChem CID 25046157) has the molecular formula C18H18N4O4S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]thiourea.
| Compound Name | 1-(2-methoxyphenyl)-3-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]thiourea |
|---|---|
| PubChem CID | 25046157 |
| Molecular Formula | C18H18N4O4S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]thiourea |
| SMILES | COc1ccccc1NC(=S)Nc1ccc(S(=O)(=O)Nc2cc(C)on2)cc1 |
| InChI | InChI=1S/C18H18N4O4S2/c1-12-11-17(21-26-12)22-28(23,24)14-9-7-13(8-10-14)19-18(27)20-15-5-3-4-6-16(15)25-2/h3-11H,1-2H3,(H,21,22)(H2,19,20,27) |
| InChIKey | VTZLDNYEYJEUOX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|