C18H15ClN4O4S2 — CID 4940444
3-chloro-N-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]carbamothioyl]benzamide (PubChem CID 4940444) has the molecular formula C18H15ClN4O4S2 and a molecular weight of 450.93 g/mol. Its IUPAC name is 3-chloro-N-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 3-chloro-N-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4940444 |
| Molecular Formula | C18H15ClN4O4S2 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | 3-chloro-N-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]carbamothioyl]benzamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)c3cccc(Cl)c3)cc2)no1 |
| InChI | InChI=1S/C18H15ClN4O4S2/c1-11-9-16(22-27-11)23-29(25,26)15-7-5-14(6-8-15)20-18(28)21-17(24)12-3-2-4-13(19)10-12/h2-10H,1H3,(H,22,23)(H2,20,21,24,28) |
| InChIKey | SJIQTTYUMPPZDE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|