C21H22N4O5S2 — CID 17142676
N-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]carbamothioyl]-3-propan-2-yloxybenzamide (PubChem CID 17142676) has the molecular formula C21H22N4O5S2 and a molecular weight of 474.56 g/mol. Its IUPAC name is N-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]carbamothioyl]-3-propan-2-yloxybenzamide.
| Compound Name | N-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]carbamothioyl]-3-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 17142676 |
| Molecular Formula | C21H22N4O5S2 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | N-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]carbamothioyl]-3-propan-2-yloxybenzamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)c3cccc(OC(C)C)c3)cc2)no1 |
| InChI | InChI=1S/C21H22N4O5S2/c1-13(2)29-17-6-4-5-15(12-17)20(26)23-21(31)22-16-7-9-18(10-8-16)32(27,28)25-19-11-14(3)30-24-19/h4-13H,1-3H3,(H,24,25)(H2,22,23,26,31) |
| InChIKey | DOPLCMSTTJGYEK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 122.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|