C20H25N3O4S2 — CID 17142715
3-propan-2-yloxy-N-[[4-(propylsulfamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 17142715) has the molecular formula C20H25N3O4S2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 3-propan-2-yloxy-N-[[4-(propylsulfamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-propan-2-yloxy-N-[[4-(propylsulfamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17142715 |
| Molecular Formula | C20H25N3O4S2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 3-propan-2-yloxy-N-[[4-(propylsulfamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | CCCNS(=O)(=O)c1ccc(NC(=S)NC(=O)c2cccc(OC(C)C)c2)cc1 |
| InChI | InChI=1S/C20H25N3O4S2/c1-4-12-21-29(25,26)18-10-8-16(9-11-18)22-20(28)23-19(24)15-6-5-7-17(13-15)27-14(2)3/h5-11,13-14,21H,4,12H2,1-3H3,(H2,22,23,24,28) |
| InChIKey | IKVKRUPRFNSPMH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|