C18H14ClFN4O4S2 — CID 2374104
2-chloro-4-fluoro-N-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]carbamothioyl]benzamide (PubChem CID 2374104) has the molecular formula C18H14ClFN4O4S2 and a molecular weight of 468.92 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 2-chloro-4-fluoro-N-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 2374104 |
| Molecular Formula | C18H14ClFN4O4S2 |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 468.01 |
| IUPAC Name | 2-chloro-4-fluoro-N-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]carbamothioyl]benzamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)c3ccc(F)cc3Cl)cc2)no1 |
| InChI | InChI=1S/C18H14ClFN4O4S2/c1-10-8-16(23-28-10)24-30(26,27)13-5-3-12(4-6-13)21-18(29)22-17(25)14-7-2-11(20)9-15(14)19/h2-9H,1H3,(H,23,24)(H2,21,22,25,29) |
| InChIKey | SSDJSVUCSKOFJE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|