C22H19Cl2N3O3S2 — CID 4934093
2,4-dichloro-N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]benzamide (PubChem CID 4934093) has the molecular formula C22H19Cl2N3O3S2 and a molecular weight of 508.45 g/mol. Its IUPAC name is 2,4-dichloro-N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 2,4-dichloro-N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4934093 |
| Molecular Formula | C22H19Cl2N3O3S2 |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 507.02 |
| IUPAC Name | 2,4-dichloro-N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]benzamide |
| SMILES | Cc1cccc(C)c1NS(=O)(=O)c1ccc(NC(=S)NC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C22H19Cl2N3O3S2/c1-13-4-3-5-14(2)20(13)27-32(29,30)17-9-7-16(8-10-17)25-22(31)26-21(28)18-11-6-15(23)12-19(18)24/h3-12,27H,1-2H3,(H2,25,26,28,31) |
| InChIKey | WIWVABVEXIGIBZ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|