C20H17Cl2N5O5S2 — CID 3520706
2,4-dichloro-N-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]benzamide (PubChem CID 3520706) has the molecular formula C20H17Cl2N5O5S2 and a molecular weight of 542.43 g/mol. Its IUPAC name is 2,4-dichloro-N-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 2,4-dichloro-N-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3520706 |
| Molecular Formula | C20H17Cl2N5O5S2 |
| Molecular Weight | 542.43 g/mol |
| Exact Mass | 541.00 |
| IUPAC Name | 2,4-dichloro-N-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]benzamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)c3ccc(Cl)cc3Cl)cc2)nc(OC)n1 |
| InChI | InChI=1S/C20H17Cl2N5O5S2/c1-31-17-10-16(24-19(25-17)32-2)27-34(29,30)13-6-4-12(5-7-13)23-20(33)26-18(28)14-8-3-11(21)9-15(14)22/h3-10H,1-2H3,(H,24,25,27)(H2,23,26,28,33) |
| InChIKey | KIKKFLHVUNZCDF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 131.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|