C26H31N5O6S2 — CID 89096448
N-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-2-hexan-2-yloxybenzamide (PubChem CID 89096448) has the molecular formula C26H31N5O6S2 and a molecular weight of 573.70 g/mol. Its IUPAC name is N-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-2-hexan-2-yloxybenzamide.
| Compound Name | N-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-2-hexan-2-yloxybenzamide |
|---|---|
| PubChem CID | 89096448 |
| Molecular Formula | C26H31N5O6S2 |
| Molecular Weight | 573.70 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | N-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-2-hexan-2-yloxybenzamide |
| SMILES | CCCCC(C)Oc1ccccc1C(=O)NC(=S)Nc1ccc(S(=O)(=O)Nc2cc(OC)nc(OC)n2)cc1 |
| InChI | InChI=1S/C26H31N5O6S2/c1-5-6-9-17(2)37-21-11-8-7-10-20(21)24(32)30-26(38)27-18-12-14-19(15-13-18)39(33,34)31-22-16-23(35-3)29-25(28-22)36-4/h7-8,10-17H,5-6,9H2,1-4H3,(H,28,29,31)(H2,27,30,32,38) |
| InChIKey | KKSYWNOAVPUWPV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 140.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.70 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|