C17H21N5O5S2 — CID 4778784
N-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-2-methylpropanamide (PubChem CID 4778784) has the molecular formula C17H21N5O5S2 and a molecular weight of 439.52 g/mol. Its IUPAC name is N-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-2-methylpropanamide.
| Compound Name | N-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 4778784 |
| Molecular Formula | C17H21N5O5S2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | N-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-2-methylpropanamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)C(C)C)cc2)nc(OC)n1 |
| InChI | InChI=1S/C17H21N5O5S2/c1-10(2)15(23)21-17(28)18-11-5-7-12(8-6-11)29(24,25)22-13-9-14(26-3)20-16(19-13)27-4/h5-10H,1-4H3,(H,19,20,22)(H2,18,21,23,28) |
| InChIKey | GCPAFBHFLYKYRZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 131.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|