C22H23N5O6S2 — CID 4635813
N-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-2-(2-methylphenoxy)acetamide (PubChem CID 4635813) has the molecular formula C22H23N5O6S2 and a molecular weight of 517.59 g/mol. Its IUPAC name is N-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-2-(2-methylphenoxy)acetamide.
| Compound Name | N-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-2-(2-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 4635813 |
| Molecular Formula | C22H23N5O6S2 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | N-[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]carbamothioyl]-2-(2-methylphenoxy)acetamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)COc3ccccc3C)cc2)nc(OC)n1 |
| InChI | InChI=1S/C22H23N5O6S2/c1-14-6-4-5-7-17(14)33-13-19(28)25-22(34)23-15-8-10-16(11-9-15)35(29,30)27-18-12-20(31-2)26-21(24-18)32-3/h4-12H,13H2,1-3H3,(H,24,26,27)(H2,23,25,28,34) |
| InChIKey | QHHHRBYNXSYAFH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 140.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|