C18H18N6O4S2 — CID 134129947
1-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-3-pyridin-4-ylthiourea (PubChem CID 134129947) has the molecular formula C18H18N6O4S2 and a molecular weight of 446.51 g/mol. Its IUPAC name is 1-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-3-pyridin-4-ylthiourea.
| Compound Name | 1-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-3-pyridin-4-ylthiourea |
|---|---|
| PubChem CID | 134129947 |
| Molecular Formula | C18H18N6O4S2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 1-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-3-pyridin-4-ylthiourea |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(NC(=S)Nc3ccncc3)cc2)nc(OC)n1 |
| InChI | InChI=1S/C18H18N6O4S2/c1-27-16-11-15(22-17(23-16)28-2)24-30(25,26)14-5-3-12(4-6-14)20-18(29)21-13-7-9-19-10-8-13/h3-11H,1-2H3,(H,22,23,24)(H2,19,20,21,29) |
| InChIKey | NSSZAHQFICWNFZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|