C14H18N4O6S2 — CID 22203987
N-(2,6-dimethoxypyrimidin-4-yl)-4-(ethylsulfonylamino)benzenesulfonamide (PubChem CID 22203987) has the molecular formula C14H18N4O6S2 and a molecular weight of 402.45 g/mol. Its IUPAC name is N-(2,6-dimethoxypyrimidin-4-yl)-4-(ethylsulfonylamino)benzenesulfonamide.
| Compound Name | N-(2,6-dimethoxypyrimidin-4-yl)-4-(ethylsulfonylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 22203987 |
| Molecular Formula | C14H18N4O6S2 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | N-(2,6-dimethoxypyrimidin-4-yl)-4-(ethylsulfonylamino)benzenesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(S(=O)(=O)Nc2cc(OC)nc(OC)n2)cc1 |
| InChI | InChI=1S/C14H18N4O6S2/c1-4-25(19,20)17-10-5-7-11(8-6-10)26(21,22)18-12-9-13(23-2)16-14(15-12)24-3/h5-9,17H,4H2,1-3H3,(H,15,16,18) |
| InChIKey | CYHJOQBAEGXGTR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |