C19H17Cl2N5O5S — CID 2206595
1-(3,4-dichlorophenyl)-3-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]urea (PubChem CID 2206595) has the molecular formula C19H17Cl2N5O5S and a molecular weight of 498.35 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]urea |
|---|---|
| PubChem CID | 2206595 |
| Molecular Formula | C19H17Cl2N5O5S |
| Molecular Weight | 498.35 g/mol |
| Exact Mass | 497.03 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]urea |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(NC(=O)Nc3ccc(Cl)c(Cl)c3)cc2)nc(OC)n1 |
| InChI | InChI=1S/C19H17Cl2N5O5S/c1-30-17-10-16(24-19(25-17)31-2)26-32(28,29)13-6-3-11(4-7-13)22-18(27)23-12-5-8-14(20)15(21)9-12/h3-10H,1-2H3,(H2,22,23,27)(H,24,25,26) |
| InChIKey | FKORHBAFGHYBQR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 131.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |